C21H20F4N4O4 — CID 19398075
N-(furan-2-ylmethyl)-1-methyl-4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]pyrazole-5-carboxamide (PubChem CID 19398075) has the molecular formula C21H20F4N4O4 and a molecular weight of 468.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-methyl-4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]pyrazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-methyl-4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19398075 |
| Molecular Formula | C21H20F4N4O4 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-methyl-4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(NC(=O)c2cccc(COCC(F)(F)C(F)F)c2)c1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C21H20F4N4O4/c1-29-17(19(31)26-9-15-6-3-7-33-15)16(10-27-29)28-18(30)14-5-2-4-13(8-14)11-32-12-21(24,25)20(22)23/h2-8,10,20H,9,11-12H2,1H3,(H,26,31)(H,28,30) |
| InChIKey | FTLWFLPJLZWEEG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|