C22H21F4N3O2 — CID 19400086
N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide (PubChem CID 19400086) has the molecular formula C22H21F4N3O2 and a molecular weight of 435.42 g/mol. Its IUPAC name is N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide.
| Compound Name | N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
|---|---|
| PubChem CID | 19400086 |
| Molecular Formula | C22H21F4N3O2 |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
| SMILES | Cc1ccc(Cn2cc(NC(=O)c3cccc(COCC(F)(F)C(F)F)c3)cn2)cc1 |
| InChI | InChI=1S/C22H21F4N3O2/c1-15-5-7-16(8-6-15)11-29-12-19(10-27-29)28-20(30)18-4-2-3-17(9-18)13-31-14-22(25,26)21(23)24/h2-10,12,21H,11,13-14H2,1H3,(H,28,30) |
| InChIKey | IFMZESHDZLQQOJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|