C21H14F9N3O2 — CID 19286751
N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide (PubChem CID 19286751) has the molecular formula C21H14F9N3O2 and a molecular weight of 511.34 g/mol. Its IUPAC name is N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide.
| Compound Name | N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
|---|---|
| PubChem CID | 19286751 |
| Molecular Formula | C21H14F9N3O2 |
| Molecular Weight | 511.34 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1)c1cccc(COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C21H14F9N3O2/c22-14-12(15(23)17(25)18(26)16(14)24)7-33-5-4-13(32-33)31-19(34)11-3-1-2-10(6-11)8-35-9-21(29,30)20(27)28/h1-6,20H,7-9H2,(H,31,32,34) |
| InChIKey | IAKAMGRJWBMINX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|