C18H12F5N3O2 — CID 19286725
3-methoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286725) has the molecular formula C18H12F5N3O2 and a molecular weight of 397.30 g/mol. Its IUPAC name is 3-methoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 3-methoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286725 |
| Molecular Formula | C18H12F5N3O2 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-methoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccn(Cc3c(F)c(F)c(F)c(F)c3F)n2)c1 |
| InChI | InChI=1S/C18H12F5N3O2/c1-28-10-4-2-3-9(7-10)18(27)24-12-5-6-26(25-12)8-11-13(19)15(21)17(23)16(22)14(11)20/h2-7H,8H2,1H3,(H,24,25,27) |
| InChIKey | LMFIJQXJWJPXAE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|