C20H14F7N3O3 — CID 19286865
4-(difluoromethoxy)-3-ethoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286865) has the molecular formula C20H14F7N3O3 and a molecular weight of 477.34 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-ethoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-ethoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286865 |
| Molecular Formula | C20H14F7N3O3 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 4-(difluoromethoxy)-3-ethoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccn(Cc3c(F)c(F)c(F)c(F)c3F)n2)ccc1OC(F)F |
| InChI | InChI=1S/C20H14F7N3O3/c1-2-32-12-7-9(3-4-11(12)33-20(26)27)19(31)28-13-5-6-30(29-13)8-10-14(21)16(23)18(25)17(24)15(10)22/h3-7,20H,2,8H2,1H3,(H,28,29,31) |
| InChIKey | UTNQJKJHVQAKGR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|