C19H14F5N3O2 — CID 19286726
4-ethoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286726) has the molecular formula C19H14F5N3O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is 4-ethoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 4-ethoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286726 |
| Molecular Formula | C19H14F5N3O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 4-ethoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccn(Cc3c(F)c(F)c(F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C19H14F5N3O2/c1-2-29-11-5-3-10(4-6-11)19(28)25-13-7-8-27(26-13)9-12-14(20)16(22)18(24)17(23)15(12)21/h3-8H,2,9H2,1H3,(H,25,26,28) |
| InChIKey | GCZKPUCJLSPFKS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|