C23H15F4N3O — CID 19286615
4-phenyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286615) has the molecular formula C23H15F4N3O and a molecular weight of 425.39 g/mol. Its IUPAC name is 4-phenyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 4-phenyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286615 |
| Molecular Formula | C23H15F4N3O |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 4-phenyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H15F4N3O/c24-18-12-19(25)22(27)17(21(18)26)13-30-11-10-20(29-30)28-23(31)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12H,13H2,(H,28,29,31) |
| InChIKey | VMNYKNHQFGRFOI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|