C17H10F4N4O3 — CID 19286417
3-nitro-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286417) has the molecular formula C17H10F4N4O3 and a molecular weight of 394.28 g/mol. Its IUPAC name is 3-nitro-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 3-nitro-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286417 |
| Molecular Formula | C17H10F4N4O3 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 3-nitro-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H10F4N4O3/c18-12-7-13(19)16(21)11(15(12)20)8-24-5-4-14(23-24)22-17(26)9-2-1-3-10(6-9)25(27)28/h1-7H,8H2,(H,22,23,26) |
| InChIKey | JMHCZBCPOVJPRT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|