C17H10F5N5O2S — CID 4771199
1-(4-nitrophenyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 4771199) has the molecular formula C17H10F5N5O2S and a molecular weight of 443.36 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(4-nitrophenyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 4771199 |
| Molecular Formula | C17H10F5N5O2S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 1-(4-nitrophenyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)Nc2ccn(Cc3c(F)c(F)c(F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C17H10F5N5O2S/c18-12-10(13(19)15(21)16(22)14(12)20)7-26-6-5-11(25-26)24-17(30)23-8-1-3-9(4-2-8)27(28)29/h1-6H,7H2,(H2,23,24,25,30) |
| InChIKey | UDRBBPHYEQVZFZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|