C14H13F5N4OS — CID 19397013
1-(2-methoxyethyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19397013) has the molecular formula C14H13F5N4OS and a molecular weight of 380.34 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19397013 |
| Molecular Formula | C14H13F5N4OS |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | COCCNC(=S)Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C14H13F5N4OS/c1-24-5-3-20-14(25)21-8-2-4-23(22-8)6-7-9(15)11(17)13(19)12(18)10(7)16/h2,4H,3,5-6H2,1H3,(H2,20,21,22,25) |
| InChIKey | JJGYEQYLAZHYCE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|