C17H9ClF5N3O — CID 19286709
2-chloro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286709) has the molecular formula C17H9ClF5N3O and a molecular weight of 401.72 g/mol. Its IUPAC name is 2-chloro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286709 |
| Molecular Formula | C17H9ClF5N3O |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-chloro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1)c1ccccc1Cl |
| InChI | InChI=1S/C17H9ClF5N3O/c18-10-4-2-1-3-8(10)17(27)24-11-5-6-26(25-11)7-9-12(19)14(21)16(23)15(22)13(9)20/h1-6H,7H2,(H,24,25,27) |
| InChIKey | SCFUYQUDAPQDHX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|