C18H14Cl2FN3OS — CID 19285625
2-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-methylsulfanylbenzamide (PubChem CID 19285625) has the molecular formula C18H14Cl2FN3OS and a molecular weight of 410.30 g/mol. Its IUPAC name is 2-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 19285625 |
| Molecular Formula | C18H14Cl2FN3OS |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 2-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)Nc2ccn(Cc3c(F)cccc3Cl)n2)c1 |
| InChI | InChI=1S/C18H14Cl2FN3OS/c1-26-11-5-6-15(20)12(9-11)18(25)22-17-7-8-24(23-17)10-13-14(19)3-2-4-16(13)21/h2-9H,10H2,1H3,(H,22,23,25) |
| InChIKey | WCAJDKPYZALDQJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |