C15H14ClFN6S — CID 19401629
1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(1-methylpyrazol-3-yl)thiourea (PubChem CID 19401629) has the molecular formula C15H14ClFN6S and a molecular weight of 364.84 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(1-methylpyrazol-3-yl)thiourea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(1-methylpyrazol-3-yl)thiourea |
|---|---|
| PubChem CID | 19401629 |
| Molecular Formula | C15H14ClFN6S |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(1-methylpyrazol-3-yl)thiourea |
| SMILES | Cn1ccc(NC(=S)Nc2ccn(Cc3c(F)cccc3Cl)n2)n1 |
| InChI | InChI=1S/C15H14ClFN6S/c1-22-7-5-13(20-22)18-15(24)19-14-6-8-23(21-14)9-10-11(16)3-2-4-12(10)17/h2-8H,9H2,1H3,(H2,18,19,20,21,24) |
| InChIKey | GTSCKVZUMMDDGB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|