C19H22ClFN6S — CID 19334102
1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea (PubChem CID 19334102) has the molecular formula C19H22ClFN6S and a molecular weight of 420.95 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 19334102 |
| Molecular Formula | C19H22ClFN6S |
| Molecular Weight | 420.95 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea |
| SMILES | Cc1cc(C)n(CCCNC(=S)Nc2ccn(Cc3c(F)cccc3Cl)n2)n1 |
| InChI | InChI=1S/C19H22ClFN6S/c1-13-11-14(2)27(24-13)9-4-8-22-19(28)23-18-7-10-26(25-18)12-15-16(20)5-3-6-17(15)21/h3,5-7,10-11H,4,8-9,12H2,1-2H3,(H2,22,23,25,28) |
| InChIKey | UQEOTOBNIWSOLH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.95 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|