C19H21BrCl2N6S — CID 19573124
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19573124) has the molecular formula C19H21BrCl2N6S and a molecular weight of 516.30 g/mol. Its IUPAC name is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19573124 |
| Molecular Formula | C19H21BrCl2N6S |
| Molecular Weight | 516.30 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1nn(CCCNC(=S)Nc2ccn(Cc3c(Cl)cccc3Cl)n2)c(C)c1Br |
| InChI | InChI=1S/C19H21BrCl2N6S/c1-12-18(20)13(2)28(25-12)9-4-8-23-19(29)24-17-7-10-27(26-17)11-14-15(21)5-3-6-16(14)22/h3,5-7,10H,4,8-9,11H2,1-2H3,(H2,23,24,26,29) |
| InChIKey | MALJBOGALDPRMW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|