C19H19ClF4N6S — CID 19572878
1-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19572878) has the molecular formula C19H19ClF4N6S and a molecular weight of 474.92 g/mol. Its IUPAC name is 1-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19572878 |
| Molecular Formula | C19H19ClF4N6S |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 1-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCCNC(=S)Nc1ccn(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C19H19ClF4N6S/c1-12-16(20)17(19(22,23)24)28-30(12)9-4-8-25-18(31)26-15-7-10-29(27-15)11-13-5-2-3-6-14(13)21/h2-3,5-7,10H,4,8-9,11H2,1H3,(H2,25,26,27,31) |
| InChIKey | RKULKQGECHBDDN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|