C18H20BrFN6S — CID 19573051
1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19573051) has the molecular formula C18H20BrFN6S and a molecular weight of 451.37 g/mol. Its IUPAC name is 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19573051 |
| Molecular Formula | C18H20BrFN6S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1nn(CCCNC(=S)Nc2ccn(Cc3ccccc3F)n2)cc1Br |
| InChI | InChI=1S/C18H20BrFN6S/c1-13-15(19)12-25(23-13)9-4-8-21-18(27)22-17-7-10-26(24-17)11-14-5-2-3-6-16(14)20/h2-3,5-7,10,12H,4,8-9,11H2,1H3,(H2,21,22,24,27) |
| InChIKey | YNYJNVNNIIMHSW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|