C13H14BrFN4S — CID 19580629
1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-ethylthiourea (PubChem CID 19580629) has the molecular formula C13H14BrFN4S and a molecular weight of 357.25 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-ethylthiourea.
| Compound Name | 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 19580629 |
| Molecular Formula | C13H14BrFN4S |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1nn(Cc2ccccc2F)cc1Br |
| InChI | InChI=1S/C13H14BrFN4S/c1-2-16-13(20)17-12-10(14)8-19(18-12)7-9-5-3-4-6-11(9)15/h3-6,8H,2,7H2,1H3,(H2,16,17,18,20) |
| InChIKey | QTILJPVKLFJRAT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|