C15H18BrClN4S — CID 17301097
1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-methylpropyl)thiourea (PubChem CID 17301097) has the molecular formula C15H18BrClN4S and a molecular weight of 401.76 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 17301097 |
| Molecular Formula | C15H18BrClN4S |
| Molecular Weight | 401.76 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1nn(Cc2ccccc2Cl)cc1Br |
| InChI | InChI=1S/C15H18BrClN4S/c1-10(2)7-18-15(22)19-14-12(16)9-21(20-14)8-11-5-3-4-6-13(11)17/h3-6,9-10H,7-8H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | DTYJBNQCNQQXKD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.76 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|