C19H18BrClN4O2S — CID 19397058
1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethoxyphenyl)thiourea (PubChem CID 19397058) has the molecular formula C19H18BrClN4O2S and a molecular weight of 481.80 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19397058 |
| Molecular Formula | C19H18BrClN4O2S |
| Molecular Weight | 481.80 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2nn(Cc3ccccc3Cl)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C19H18BrClN4O2S/c1-26-13-7-8-16(17(9-13)27-2)22-19(28)23-18-14(20)11-25(24-18)10-12-5-3-4-6-15(12)21/h3-9,11H,10H2,1-2H3,(H2,22,23,24,28) |
| InChIKey | BIEMONMEJYCMQQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.80 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|