C18H16BrFN4OS — CID 19397182
1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxyphenyl)thiourea (PubChem CID 19397182) has the molecular formula C18H16BrFN4OS and a molecular weight of 435.32 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19397182 |
| Molecular Formula | C18H16BrFN4OS |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)Nc2nn(Cc3ccccc3F)cc2Br)c1 |
| InChI | InChI=1S/C18H16BrFN4OS/c1-25-14-7-4-6-13(9-14)21-18(26)22-17-15(19)11-24(23-17)10-12-5-2-3-8-16(12)20/h2-9,11H,10H2,1H3,(H2,21,22,23,26) |
| InChIKey | WVDLUMVCEVDOGQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|