C19H18BrFN4OS — CID 19397175
1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-ethoxyphenyl)thiourea (PubChem CID 19397175) has the molecular formula C19H18BrFN4OS and a molecular weight of 449.35 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-ethoxyphenyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19397175 |
| Molecular Formula | C19H18BrFN4OS |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 1-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccccc1NC(=S)Nc1nn(Cc2ccccc2F)cc1Br |
| InChI | InChI=1S/C19H18BrFN4OS/c1-2-26-17-10-6-5-9-16(17)22-19(27)23-18-14(20)12-25(24-18)11-13-7-3-4-8-15(13)21/h3-10,12H,2,11H2,1H3,(H2,22,23,24,27) |
| InChIKey | DZLZXWIPERZJJG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|