C20H22N4OS — CID 19342898
1-(2-ethoxyphenyl)-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19342898) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19342898 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCOc1ccccc1NC(=S)Nc1cnn(Cc2ccccc2C)c1 |
| InChI | InChI=1S/C20H22N4OS/c1-3-25-19-11-7-6-10-18(19)23-20(26)22-17-12-21-24(14-17)13-16-9-5-4-8-15(16)2/h4-12,14H,3,13H2,1-2H3,(H2,22,23,26) |
| InChIKey | IWZSXPTWJZNHEA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|