C20H20F2N4OS — CID 19342916
1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19342916) has the molecular formula C20H20F2N4OS and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19342916 |
| Molecular Formula | C20H20F2N4OS |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1ccc(OC(F)F)c(NC(=S)Nc2cnn(Cc3ccccc3C)c2)c1 |
| InChI | InChI=1S/C20H20F2N4OS/c1-13-7-8-18(27-19(21)22)17(9-13)25-20(28)24-16-10-23-26(12-16)11-15-6-4-3-5-14(15)2/h3-10,12,19H,11H2,1-2H3,(H2,24,25,28) |
| InChIKey | FWNCODXMINVGCO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|