C19H14F6N4OS — CID 19343665
1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19343665) has the molecular formula C19H14F6N4OS and a molecular weight of 460.40 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19343665 |
| Molecular Formula | C19H14F6N4OS |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1ccc(OC(F)F)c(NC(=S)Nc2cnn(Cc3c(F)cc(F)c(F)c3F)c2)c1 |
| InChI | InChI=1S/C19H14F6N4OS/c1-9-2-3-15(30-18(24)25)14(4-9)28-19(31)27-10-6-26-29(7-10)8-11-12(20)5-13(21)17(23)16(11)22/h2-7,18H,8H2,1H3,(H2,27,28,31) |
| InChIKey | PKWJDDXOPXXKQN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|