C18H18F4N6S — CID 19343662
1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19343662) has the molecular formula C18H18F4N6S and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19343662 |
| Molecular Formula | C18H18F4N6S |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCn1cc(CNC(=S)Nc2cnn(Cc3c(F)cc(F)c(F)c3F)c2)c(C)n1 |
| InChI | InChI=1S/C18H18F4N6S/c1-3-27-7-11(10(2)26-27)5-23-18(29)25-12-6-24-28(8-12)9-13-14(19)4-15(20)17(22)16(13)21/h4,6-8H,3,5,9H2,1-2H3,(H2,23,25,29) |
| InChIKey | LQCSZZVWRXOYJP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|