C11H20N4S — CID 19324952
1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-propylthiourea (PubChem CID 19324952) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-propylthiourea.
| Compound Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-propylthiourea |
|---|---|
| PubChem CID | 19324952 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NCc1cn(CC)nc1C |
| InChI | InChI=1S/C11H20N4S/c1-4-6-12-11(16)13-7-10-8-15(5-2)14-9(10)3/h8H,4-7H2,1-3H3,(H2,12,13,16) |
| InChIKey | NNHYPCTXNXKVMM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|