C15H18F2N4OS — CID 19324966
1-[2-(difluoromethoxy)phenyl]-3-[(1-ethyl-3-methylpyrazol-4-yl)methyl]thiourea (PubChem CID 19324966) has the molecular formula C15H18F2N4OS and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-3-[(1-ethyl-3-methylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-3-[(1-ethyl-3-methylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19324966 |
| Molecular Formula | C15H18F2N4OS |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-3-[(1-ethyl-3-methylpyrazol-4-yl)methyl]thiourea |
| SMILES | CCn1cc(CNC(=S)Nc2ccccc2OC(F)F)c(C)n1 |
| InChI | InChI=1S/C15H18F2N4OS/c1-3-21-9-11(10(2)20-21)8-18-15(23)19-12-6-4-5-7-13(12)22-14(16)17/h4-7,9,14H,3,8H2,1-2H3,(H2,18,19,23) |
| InChIKey | QVEWVOKHQCYQGZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|