C13H14F2N4OS — CID 19571852
1-[2-(difluoromethoxy)phenyl]-3-[(1-methylpyrazol-3-yl)methyl]thiourea (PubChem CID 19571852) has the molecular formula C13H14F2N4OS and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-3-[(1-methylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-3-[(1-methylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19571852 |
| Molecular Formula | C13H14F2N4OS |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-3-[(1-methylpyrazol-3-yl)methyl]thiourea |
| SMILES | Cn1ccc(CNC(=S)Nc2ccccc2OC(F)F)n1 |
| InChI | InChI=1S/C13H14F2N4OS/c1-19-7-6-9(18-19)8-16-13(21)17-10-4-2-3-5-11(10)20-12(14)15/h2-7,12H,8H2,1H3,(H2,16,17,21) |
| InChIKey | UDUKCKXJGKDAQW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|