C13H15F2N3O2 — CID 64831321
2-[4-[[2-(difluoromethoxy)anilino]methyl]pyrazol-1-yl]ethanol (PubChem CID 64831321) has the molecular formula C13H15F2N3O2 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[4-[[2-(difluoromethoxy)anilino]methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[[2-(difluoromethoxy)anilino]methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 64831321 |
| Molecular Formula | C13H15F2N3O2 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[4-[[2-(difluoromethoxy)anilino]methyl]pyrazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2ccccc2OC(F)F)cn1 |
| InChI | InChI=1S/C13H15F2N3O2/c14-13(15)20-12-4-2-1-3-11(12)16-7-10-8-17-18(9-10)5-6-19/h1-4,8-9,13,16,19H,5-7H2 |
| InChIKey | INGMVUGMYXZCSX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |