C13H18N4O3S — CID 64830564
2-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]-N-methylbenzenesulfonamide (PubChem CID 64830564) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]-N-methylbenzenesulfonamide.
| Compound Name | 2-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 64830564 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1NCc1cnn(CCO)c1 |
| InChI | InChI=1S/C13H18N4O3S/c1-14-21(19,20)13-5-3-2-4-12(13)15-8-11-9-16-17(10-11)6-7-18/h2-5,9-10,14-15,18H,6-8H2,1H3 |
| InChIKey | XPQNGRZXTDVVGB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |