C16H22N4O — CID 103818567
N-methyl-2-[2-[(1-propylpyrazol-4-yl)methylamino]phenyl]acetamide (PubChem CID 103818567) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is N-methyl-2-[2-[(1-propylpyrazol-4-yl)methylamino]phenyl]acetamide.
| Compound Name | N-methyl-2-[2-[(1-propylpyrazol-4-yl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 103818567 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N-methyl-2-[2-[(1-propylpyrazol-4-yl)methylamino]phenyl]acetamide |
| SMILES | CCCn1cc(CNc2ccccc2CC(=O)NC)cn1 |
| InChI | InChI=1S/C16H22N4O/c1-3-8-20-12-13(11-19-20)10-18-15-7-5-4-6-14(15)9-16(21)17-2/h4-7,11-12,18H,3,8-10H2,1-2H3,(H,17,21) |
| InChIKey | PJSJYRPONNBUJR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |