About 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide
2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide (PubChem CID 83089797) has the molecular formula C13H18N4O2S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide |
| PubChem CID | 83089797 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1NCc1cn(C)nc1C |
| InChI | InChI=1S/C13H18N4O2S/c1-10-11(9-17(3)16-10)8-15-12-6-4-5-7-13(12)20(18,19)14-2/h4-7,9,14-15H,8H2,1-3H3 |
| InChIKey | PFUXFUHIICELJW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide?
The IUPAC name of 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide (CID 83089797) is 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide.
What is the SMILES notation for 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide?
The canonical SMILES for 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide is CNS(=O)(=O)c1ccccc1NCc1cn(C)nc1C.
What is the InChIKey of 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide?
The InChIKey is PFUXFUHIICELJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2S/c1-10-11(9-17(3)16-10)8-15-12-6-4-5-7-13(12)20(18,19)14-2/h4-7,9,14-15H,8H2,1-3H3.
What are the key properties of 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide?
2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide has a molecular weight of 294.38 g/mol, XLogP of 1.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-methylbenzenesulfonamide is sourced from PubChem (CID 83089797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).