C16H17N3O — CID 83089796
5-[(1,3-dimethylpyrazol-4-yl)methylamino]naphthalen-1-ol (PubChem CID 83089796) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-[(1,3-dimethylpyrazol-4-yl)methylamino]naphthalen-1-ol.
| Compound Name | 5-[(1,3-dimethylpyrazol-4-yl)methylamino]naphthalen-1-ol |
|---|---|
| PubChem CID | 83089796 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 5-[(1,3-dimethylpyrazol-4-yl)methylamino]naphthalen-1-ol |
| SMILES | Cc1nn(C)cc1CNc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C16H17N3O/c1-11-12(10-19(2)18-11)9-17-15-7-3-6-14-13(15)5-4-8-16(14)20/h3-8,10,17,20H,9H2,1-2H3 |
| InChIKey | VHVVGAKVJBXFOJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |