C15H21N3O2S — CID 115990563
N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-propylsulfonylaniline (PubChem CID 115990563) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-propylsulfonylaniline.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-propylsulfonylaniline |
|---|---|
| PubChem CID | 115990563 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-propylsulfonylaniline |
| SMILES | CCCS(=O)(=O)c1ccccc1NCc1cn(C)nc1C |
| InChI | InChI=1S/C15H21N3O2S/c1-4-9-21(19,20)15-8-6-5-7-14(15)16-10-13-11-18(3)17-12(13)2/h5-8,11,16H,4,9-10H2,1-3H3 |
| InChIKey | OPSCMMJUNCKWKS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |