C12H14N4O4S — CID 22209381
N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-nitrobenzenesulfonamide (PubChem CID 22209381) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 22209381 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-nitrobenzenesulfonamide |
| SMILES | Cc1nn(C)cc1CNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O4S/c1-9-10(8-15(2)14-9)7-13-21(19,20)12-6-4-3-5-11(12)16(17)18/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | KNDAQYSOXCYVLF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|