C14H20F2N2OS — CID 2384385
1-[2-(difluoromethoxy)phenyl]-3-[(2S)-3,3-dimethylbutan-2-yl]thiourea (PubChem CID 2384385) has the molecular formula C14H20F2N2OS and a molecular weight of 302.39 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-3-[(2S)-3,3-dimethylbutan-2-yl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-3-[(2S)-3,3-dimethylbutan-2-yl]thiourea |
|---|---|
| PubChem CID | 2384385 |
| Molecular Formula | C14H20F2N2OS |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-3-[(2S)-3,3-dimethylbutan-2-yl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccccc1OC(F)F)C(C)(C)C |
| InChI | InChI=1S/C14H20F2N2OS/c1-9(14(2,3)4)17-13(20)18-10-7-5-6-8-11(10)19-12(15)16/h5-9,12H,1-4H3,(H2,17,18,20)/t9-/m0/s1 |
| InChIKey | HVSIKBYHUDFOEQ-VIFPVBQESA-N |
| XLogP | 4.01 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|