C16H10F6N2O3S — CID 22778050
N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 22778050) has the molecular formula C16H10F6N2O3S and a molecular weight of 424.32 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 22778050 |
| Molecular Formula | C16H10F6N2O3S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccccc2OC(F)F)c(F)c1F |
| InChI | InChI=1S/C16H10F6N2O3S/c1-26-13-11(19)9(17)8(10(18)12(13)20)14(25)24-16(28)23-6-4-2-3-5-7(6)27-15(21)22/h2-5,15H,1H3,(H2,23,24,25,28) |
| InChIKey | SJGLRCMPURHFTC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|