C16H8ClF7N2O2S — CID 17104896
N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17104896) has the molecular formula C16H8ClF7N2O2S and a molecular weight of 460.76 g/mol. Its IUPAC name is N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17104896 |
| Molecular Formula | C16H8ClF7N2O2S |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc(C(F)(F)F)cc2Cl)c(F)c1F |
| InChI | InChI=1S/C16H8ClF7N2O2S/c1-28-13-11(20)9(18)8(10(19)12(13)21)14(27)26-15(29)25-7-3-2-5(4-6(7)17)16(22,23)24/h2-4H,1H3,(H2,25,26,27,29) |
| InChIKey | ZMMWWSFLSSNCAN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|