C17H14ClF3N2O3S — CID 17335722
N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2,4-dimethoxybenzamide (PubChem CID 17335722) has the molecular formula C17H14ClF3N2O3S and a molecular weight of 418.82 g/mol. Its IUPAC name is N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17335722 |
| Molecular Formula | C17H14ClF3N2O3S |
| Molecular Weight | 418.82 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(C(F)(F)F)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C17H14ClF3N2O3S/c1-25-10-4-5-11(14(8-10)26-2)15(24)23-16(27)22-13-6-3-9(7-12(13)18)17(19,20)21/h3-8H,1-2H3,(H2,22,23,24,27) |
| InChIKey | FPNJKTYMCWNBLP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|