C16H12ClF3N2O2S — CID 1335728
N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 1335728) has the molecular formula C16H12ClF3N2O2S and a molecular weight of 388.80 g/mol. Its IUPAC name is N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 1335728 |
| Molecular Formula | C16H12ClF3N2O2S |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H12ClF3N2O2S/c1-24-11-5-2-9(3-6-11)14(23)22-15(25)21-13-8-10(16(18,19)20)4-7-12(13)17/h2-8H,1H3,(H2,21,22,23,25) |
| InChIKey | ZGJCJHTZDBKXFV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|