C19H16Cl2F3N3OS — CID 17307915
3,4-dichloro-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 17307915) has the molecular formula C19H16Cl2F3N3OS and a molecular weight of 462.32 g/mol. Its IUPAC name is 3,4-dichloro-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17307915 |
| Molecular Formula | C19H16Cl2F3N3OS |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 3,4-dichloro-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cc(C(F)(F)F)ccc1N1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2F3N3OS/c20-13-5-3-11(9-14(13)21)17(28)26-18(29)25-15-10-12(19(22,23)24)4-6-16(15)27-7-1-2-8-27/h3-6,9-10H,1-2,7-8H2,(H2,25,26,28,29) |
| InChIKey | CQVKSXOQNDXXMX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|