C18H17Cl2N3O2S — CID 1278265
3,4-dichloro-N-[(2-morpholin-4-ylphenyl)carbamothioyl]benzamide (PubChem CID 1278265) has the molecular formula C18H17Cl2N3O2S and a molecular weight of 410.33 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2-morpholin-4-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(2-morpholin-4-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1278265 |
| Molecular Formula | C18H17Cl2N3O2S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 3,4-dichloro-N-[(2-morpholin-4-ylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1N1CCOCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N3O2S/c19-13-6-5-12(11-14(13)20)17(24)22-18(26)21-15-3-1-2-4-16(15)23-7-9-25-10-8-23/h1-6,11H,7-10H2,(H2,21,22,24,26) |
| InChIKey | OOYAQQMQHGTGQX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|