C20H19Cl2N3O4S — CID 17336341
methyl 3-[(3,4-dichlorobenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate (PubChem CID 17336341) has the molecular formula C20H19Cl2N3O4S and a molecular weight of 468.36 g/mol. Its IUPAC name is methyl 3-[(3,4-dichlorobenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate.
| Compound Name | methyl 3-[(3,4-dichlorobenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 17336341 |
| Molecular Formula | C20H19Cl2N3O4S |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | methyl 3-[(3,4-dichlorobenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1ccc(N2CCOCC2)c(NC(=S)NC(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C20H19Cl2N3O4S/c1-28-19(27)13-3-5-17(25-6-8-29-9-7-25)16(11-13)23-20(30)24-18(26)12-2-4-14(21)15(22)10-12/h2-5,10-11H,6-9H2,1H3,(H2,23,24,26,30) |
| InChIKey | FRNRGQDBMOGEGA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|