C20H19ClN4O7S — CID 28688204
3-chloro-4-methoxy-5-[(4-morpholin-4-yl-3-nitrobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 28688204) has the molecular formula C20H19ClN4O7S and a molecular weight of 494.91 g/mol. Its IUPAC name is 3-chloro-4-methoxy-5-[(4-morpholin-4-yl-3-nitrobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 3-chloro-4-methoxy-5-[(4-morpholin-4-yl-3-nitrobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 28688204 |
| Molecular Formula | C20H19ClN4O7S |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 3-chloro-4-methoxy-5-[(4-morpholin-4-yl-3-nitrobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | COc1c(Cl)cc(C(=O)O)cc1NC(=S)NC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19ClN4O7S/c1-31-17-13(21)8-12(19(27)28)9-14(17)22-20(33)23-18(26)11-2-3-15(16(10-11)25(29)30)24-4-6-32-7-5-24/h2-3,8-10H,4-7H2,1H3,(H,27,28)(H2,22,23,26,33) |
| InChIKey | VYWJFXGNMSYKJL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|