C19H20ClN3O6 — CID 2979765
N-(4-chloro-2,5-dimethoxyphenyl)-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 2979765) has the molecular formula C19H20ClN3O6 and a molecular weight of 421.84 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 2979765 |
| Molecular Formula | C19H20ClN3O6 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H20ClN3O6/c1-27-17-11-14(18(28-2)10-13(17)20)21-19(24)12-3-4-15(16(9-12)23(25)26)22-5-7-29-8-6-22/h3-4,9-11H,5-8H2,1-2H3,(H,21,24) |
| InChIKey | VWDOZMUMZJWFQB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|