C20H21ClN4O6S — CID 23097995
N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 23097995) has the molecular formula C20H21ClN4O6S and a molecular weight of 480.93 g/mol. Its IUPAC name is N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 23097995 |
| Molecular Formula | C20H21ClN4O6S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H21ClN4O6S/c1-29-17-11-15(18(30-2)10-14(17)21)22-20(32)23-19(26)13-9-12(25(27)28)3-4-16(13)24-5-7-31-8-6-24/h3-4,9-11H,5-8H2,1-2H3,(H2,22,23,26,32) |
| InChIKey | COODOLULNUTNCX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|