C15H18N8O4S — CID 17334703
N-[(2-ethyltetrazol-5-yl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 17334703) has the molecular formula C15H18N8O4S and a molecular weight of 406.43 g/mol. Its IUPAC name is N-[(2-ethyltetrazol-5-yl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[(2-ethyltetrazol-5-yl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 17334703 |
| Molecular Formula | C15H18N8O4S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[(2-ethyltetrazol-5-yl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CCn1nnc(NC(=S)NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)n1 |
| InChI | InChI=1S/C15H18N8O4S/c1-2-22-19-14(18-20-22)17-15(28)16-13(24)11-9-10(23(25)26)3-4-12(11)21-5-7-27-8-6-21/h3-4,9H,2,5-8H2,1H3,(H2,16,17,19,24,28) |
| InChIKey | PBLCJEUCUTZEKR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|