C14H15N5O4S — CID 5298949
N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 5298949) has the molecular formula C14H15N5O4S and a molecular weight of 349.37 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 5298949 |
| Molecular Formula | C14H15N5O4S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | Cc1nnc(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)s1 |
| InChI | InChI=1S/C14H15N5O4S/c1-9-16-17-14(24-9)15-13(20)11-8-10(19(21)22)2-3-12(11)18-4-6-23-7-5-18/h2-3,8H,4-7H2,1H3,(H,15,17,20) |
| InChIKey | QCBVJLPOUQDFPZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|