C19H18N4O4S — CID 7408940
N-(4-methyl-1,3-benzothiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 7408940) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-(4-methyl-1,3-benzothiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-(4-methyl-1,3-benzothiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 7408940 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(4-methyl-1,3-benzothiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | Cc1cccc2sc(NC(=O)c3cc([N+](=O)[O-])ccc3N3CCOCC3)nc12 |
| InChI | InChI=1S/C19H18N4O4S/c1-12-3-2-4-16-17(12)20-19(28-16)21-18(24)14-11-13(23(25)26)5-6-15(14)22-7-9-27-10-8-22/h2-6,11H,7-10H2,1H3,(H,20,21,24) |
| InChIKey | RXLOZBKMXYZQRP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|